CAS 82-20-2 appears in our catalog under these names: N-Hydroxysuccinate, 1,5-Di-p-toluidinoanthraquinone. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 2,5g.
1,5-bis(4-methylanilino)anthracene-9,10-dione (CAS 82-20-2) is a chemical compound with the molecular formula C28H22N2O2 and a molecular weight of 418.5 g/mol. IUPAC name: 1,5-bis(4-methylanilino)anthracene-9,10-dione. InChIKey: ZKIVUFFTMWIBCO-UHFFFAOYSA-N.
| Molecular formula | C28H22N2O2 |
|---|---|
| Molecular weight | 418.5 g/mol |
| IUPAC name | 1,5-bis(4-methylanilino)anthracene-9,10-dione |
| InChIKey | ZKIVUFFTMWIBCO-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)NC2=CC=CC3=C2C(=O)C4=C(C3=O)C(=CC=C4)NC5=CC=C(C=C5)C |
Computed by PubChem (NCBI)