Products 262361-54-6
CAS 262361-54-6 appears in our catalog under these names: N-Methyl-L-tyrosine hydrochloride, (2S)-3-(4-hydroxyphenyl)-2-(methylamino)propanoic acid hydrochloride, 97%, 97%. Offered by: TRC, Chemat. Available pack sizes: 2,5g, 100mg, 500mg, 1g.
(2S)-3-(4-hydroxyphenyl)-2-(methylamino)propanoic acid;hydrochloride (CAS 262361-54-6) is a chemical compound with the molecular formula C10H14ClNO3 and a molecular weight of 231.67 g/mol. IUPAC name: (2S)-3-(4-hydroxyphenyl)-2-(methylamino)propanoic acid;hydrochloride. InChIKey: LIDVIUGMMFTRSD-FVGYRXGTSA-N.
| Molecular formula | C10H14ClNO3 |
|---|---|
| Molecular weight | 231.67 g/mol |
| IUPAC name | (2S)-3-(4-hydroxyphenyl)-2-(methylamino)propanoic acid;hydrochloride |
| InChIKey | LIDVIUGMMFTRSD-FVGYRXGTSA-N |
| SMILES | CN[C@@H](CC1=CC=C(C=C1)O)C(=O)O.Cl |
Computed by PubChem (NCBI)