Products 26250-89-5
CAS 26250-89-5 appears in our catalog under these names: 3-Amino-2-benzylpropanoic acid hydrochloride, 95%, 2-aminomethyl-3-phenylpropionic acid hcl. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 10g, 1g, 5g, 2,5g.
2-(aminomethyl)-3-phenylpropanoic acid;hydrochloride (CAS 26250-89-5) is a chemical compound with the molecular formula C10H14ClNO2 and a molecular weight of 215.67 g/mol. IUPAC name: 2-(aminomethyl)-3-phenylpropanoic acid;hydrochloride. InChIKey: HIYMCIGQCWOWJV-UHFFFAOYSA-N.
| Molecular formula | C10H14ClNO2 |
|---|---|
| Molecular weight | 215.67 g/mol |
| IUPAC name | 2-(aminomethyl)-3-phenylpropanoic acid;hydrochloride |
| InChIKey | HIYMCIGQCWOWJV-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CC(CN)C(=O)O.Cl |
Computed by PubChem (NCBI)
Synonyms:
2-Aminomethyl-3-phenyl-propionic acid hydrochloride, 3-amino-2-benzylpropanoic acid hydrochloride, 3-Amino-2-benzylpropanoicacidhydrochloride, 2-(aminomethyl)-3-phenylpropanoic acid;hydrochloride, 2-(Aminomethyl)-3-phenylpropionic acid hydrochloride, 2-(Aminomethyl)-3-phenylpropionic acid HCl, rac 3-Amino-2-benzyl-propionic acid x HCl, a-(Aminomethyl)-benzenepropanoic acid hydrochloride, rac 3-Amino-2-benzyl-propionic acid hydrochloride, 2-(aminomethyl)-3-phenyl-propanoic acid;hydrochloride