Products 2629316-04-5
CAS 2629316-04-5 is the registry number for 6-Bromo-4-(chloromethyl)phthalazin-1(2H)-one, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
6-bromo-4-(chloromethyl)-2H-phthalazin-1-one (CAS 2629316-04-5) is a chemical compound with the molecular formula C9H6BrClN2O and a molecular weight of 273.51 g/mol. IUPAC name: 6-bromo-4-(chloromethyl)-2H-phthalazin-1-one. InChIKey: CJUOBTWSCSMZQM-UHFFFAOYSA-N.
| Molecular formula | C9H6BrClN2O |
|---|---|
| Molecular weight | 273.51 g/mol |
| IUPAC name | 6-bromo-4-(chloromethyl)-2H-phthalazin-1-one |
| InChIKey | CJUOBTWSCSMZQM-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Br)C(=NNC2=O)CCl |
Computed by PubChem (NCBI)