CAS 263021-30-3 appears in our catalog under these names: N-Boc-4-(methylamino)benzoic acid, 95%, 4-((tert-Butoxycarbonyl)(methyl)amino)benzoic acid, 95-<97%, 4-((tert-Butoxycarbonyl)(methyl)amino)benzoic acid, ≥97-<99%, 4–N–Boc–N–methylaminobenzoicAcid, Benzoic acid, 4-[[(1,1-dimethylethoxy)carbonyl]methylamino]-, 97%, 97%. Offered by: Combi-blocks, Hoffman Fine Chemicals, GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 50g, 100g, 200g, 300g, 400g, 500g.
4-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]benzoic acid (CAS 263021-30-3) is a chemical compound with the molecular formula C13H17NO4 and a molecular weight of 251.28 g/mol. IUPAC name: 4-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]benzoic acid. InChIKey: VRQKKKZQZSNRKD-UHFFFAOYSA-N.
| Molecular formula | C13H17NO4 |
|---|---|
| Molecular weight | 251.28 g/mol |
| IUPAC name | 4-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]benzoic acid |
| InChIKey | VRQKKKZQZSNRKD-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N(C)C1=CC=C(C=C1)C(=O)O |
Computed by PubChem (NCBI)