Products 263365-53-3
CAS 263365-53-3 is the registry number for 3-Hydroxy-6,2',4'-trimethoxyflavone. Offered by: Biosynth. Available pack sizes: 25mg, 50mg, 100mg, 250mg.
2-(2,4-dimethoxyphenyl)-3-hydroxy-6-methoxychromen-4-one (CAS 263365-53-3) is a chemical compound with the molecular formula C18H16O6 and a molecular weight of 328.3 g/mol. IUPAC name: 2-(2,4-dimethoxyphenyl)-3-hydroxy-6-methoxychromen-4-one. InChIKey: LJVMNMMAZVWXPY-UHFFFAOYSA-N.
| Molecular formula | C18H16O6 |
|---|---|
| Molecular weight | 328.3 g/mol |
| IUPAC name | 2-(2,4-dimethoxyphenyl)-3-hydroxy-6-methoxychromen-4-one |
| InChIKey | LJVMNMMAZVWXPY-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)OC(=C(C2=O)O)C3=C(C=C(C=C3)OC)OC |
Computed by PubChem (NCBI)