CAS 263396-43-6 appears in our catalog under these names: (R)–2–Amino–3–(3–cyanophenyl)propanoic acid, D-3-Cyanophenylalanine, 97%, 97%, (R)-2-Amino-3-(3-cyanophenyl)propanoic acid, 97%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 10g, 25g, 5g, 250mg, 1g, 100g.
(2R)-2-amino-3-(3-cyanophenyl)propanoic acid (CAS 263396-43-6) is a chemical compound with the molecular formula C10H10N2O2 and a molecular weight of 190.20 g/mol. IUPAC name: (2R)-2-amino-3-(3-cyanophenyl)propanoic acid. InChIKey: ZHUOMTMPTNZOJE-SECBINFHSA-N.
| Molecular formula | C10H10N2O2 |
|---|---|
| Molecular weight | 190.20 g/mol |
| IUPAC name | (2R)-2-amino-3-(3-cyanophenyl)propanoic acid |
| InChIKey | ZHUOMTMPTNZOJE-SECBINFHSA-N |
| SMILES | C1=CC(=CC(=C1)C#N)C[C@H](C(=O)O)N |
Computed by PubChem (NCBI)