CAS 2636048-66-1 is the registry number for 2-Chloro-8-methoxy-1,7-naphthyridine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-chloro-8-methoxy-1,7-naphthyridine (CAS 2636048-66-1) is a chemical compound with the molecular formula C9H7ClN2O and a molecular weight of 194.62 g/mol. IUPAC name: 2-chloro-8-methoxy-1,7-naphthyridine. InChIKey: BCBKGDPBEBWKNU-UHFFFAOYSA-N.
| Molecular formula | C9H7ClN2O |
|---|---|
| Molecular weight | 194.62 g/mol |
| IUPAC name | 2-chloro-8-methoxy-1,7-naphthyridine |
| InChIKey | BCBKGDPBEBWKNU-UHFFFAOYSA-N |
| SMILES | COC1=NC=CC2=C1N=C(C=C2)Cl |
Computed by PubChem (NCBI)