CAS 2636814-69-0 is the registry number for 5-Chloro-2-methoxy-6-nitro-1,8-naphthyridine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-chloro-2-methoxy-6-nitro-1,8-naphthyridine (CAS 2636814-69-0) is a chemical compound with the molecular formula C9H6ClN3O3 and a molecular weight of 239.61 g/mol. IUPAC name: 5-chloro-2-methoxy-6-nitro-1,8-naphthyridine. InChIKey: CRVOEHDCZREYIV-UHFFFAOYSA-N.
| Molecular formula | C9H6ClN3O3 |
|---|---|
| Molecular weight | 239.61 g/mol |
| IUPAC name | 5-chloro-2-methoxy-6-nitro-1,8-naphthyridine |
| InChIKey | CRVOEHDCZREYIV-UHFFFAOYSA-N |
| SMILES | COC1=NC2=NC=C(C(=C2C=C1)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)