CAS 97609-02-4 appears in our catalog under these names: 2-(6-Chloro-4-oxobenzo[d][1,2,3]triazin-3(4H)-yl)acetic acid, 98%, 98%, 2-(6-Chloro-4-oxobenzo[d][1,2,3]triazin-3(4H)-yl)acetic acid, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
2-(6-chloro-4-oxo-1,2,3-benzotriazin-3-yl)acetic acid (CAS 97609-02-4) is a chemical compound with the molecular formula C9H6ClN3O3 and a molecular weight of 239.61 g/mol. IUPAC name: 2-(6-chloro-4-oxo-1,2,3-benzotriazin-3-yl)acetic acid. InChIKey: WZNQDQCCAOSQLM-UHFFFAOYSA-N.
| Molecular formula | C9H6ClN3O3 |
|---|---|
| Molecular weight | 239.61 g/mol |
| IUPAC name | 2-(6-chloro-4-oxo-1,2,3-benzotriazin-3-yl)acetic acid |
| InChIKey | WZNQDQCCAOSQLM-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Cl)C(=O)N(N=N2)CC(=O)O |
Computed by PubChem (NCBI)