CAS 50677-30-0 is the registry number for 2-(Chloromethyl)-5-(4-nitrophenyl)-1,3,4-oxadiazole. Offered by: Biosynth. Available pack sizes: 5g, 0,5g.
2-(chloromethyl)-5-(4-nitrophenyl)-1,3,4-oxadiazole (CAS 50677-30-0) is a chemical compound with the molecular formula C9H6ClN3O3 and a molecular weight of 239.61 g/mol. IUPAC name: 2-(chloromethyl)-5-(4-nitrophenyl)-1,3,4-oxadiazole. InChIKey: RFQRLMXKFHKCIW-UHFFFAOYSA-N.
| Molecular formula | C9H6ClN3O3 |
|---|---|
| Molecular weight | 239.61 g/mol |
| IUPAC name | 2-(chloromethyl)-5-(4-nitrophenyl)-1,3,4-oxadiazole |
| InChIKey | RFQRLMXKFHKCIW-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NN=C(O2)CCl)[N+](=O)[O-] |
Computed by PubChem (NCBI)