Products 57611-19-5
CAS 57611-19-5 appears in our catalog under these names: 5-(Chloromethyl)-3-(4-nitrophenyl)-1,2,4-oxadiazole, 5-(Chloromethyl)-3-(4-nitrophenyl)-1,2,4-oxadiazole, 98%, 5-(Chloromethyl)-3-(4-nitrophenyl)-1，2，4-oxadiazole, 95%, 95%, 5-Chloromethyl-3-(4-nitro-phenyl)-[1,2,4]oxadiazole, 95%. Offered by: Biosynth, Combi-blocks, Chemat, Fluorochem, Ambeed. Available pack sizes: 2,5g, 10g, 1g, 5g, 100mg, 250mg, 25g, 100g.
5-(chloromethyl)-3-(4-nitrophenyl)-1,2,4-oxadiazole (CAS 57611-19-5) is a chemical compound with the molecular formula C9H6ClN3O3 and a molecular weight of 239.61 g/mol. IUPAC name: 5-(chloromethyl)-3-(4-nitrophenyl)-1,2,4-oxadiazole. InChIKey: DKZJFBGPUIIFGW-UHFFFAOYSA-N.
| Molecular formula | C9H6ClN3O3 |
|---|---|
| Molecular weight | 239.61 g/mol |
| IUPAC name | 5-(chloromethyl)-3-(4-nitrophenyl)-1,2,4-oxadiazole |
| InChIKey | DKZJFBGPUIIFGW-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NOC(=N2)CCl)[N+](=O)[O-] |
Computed by PubChem (NCBI)