Products 6595-78-4
CAS 6595-78-4 appears in our catalog under these names: 5-(Chloromethyl)-3-(3-nitrophenyl)-1,2,4-oxadiazole, 98%, 5-(Chloromethyl)-3-(3-nitrophenyl)-1,2,4-oxadiazole, 5-Chloromethyl-3-(3-nitro-phenyl)-[1,2,4]oxadiazole, 97%. Offered by: Combi-blocks, AmBeed, Biosynth, Fluorochem. Available pack sizes: 25g, 1g, 100g, 5g, 2,5g, 0,25g.
5-(chloromethyl)-3-(3-nitrophenyl)-1,2,4-oxadiazole (CAS 6595-78-4) is a chemical compound with the molecular formula C9H6ClN3O3 and a molecular weight of 239.61 g/mol. IUPAC name: 5-(chloromethyl)-3-(3-nitrophenyl)-1,2,4-oxadiazole. InChIKey: QJMVUDOJNDEBTE-UHFFFAOYSA-N.
| Molecular formula | C9H6ClN3O3 |
|---|---|
| Molecular weight | 239.61 g/mol |
| IUPAC name | 5-(chloromethyl)-3-(3-nitrophenyl)-1,2,4-oxadiazole |
| InChIKey | QJMVUDOJNDEBTE-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)[N+](=O)[O-])C2=NOC(=N2)CCl |
Computed by PubChem (NCBI)