CAS 2638501-76-3 is the registry number for 5-Bromo-7-nitroquinoline, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
5-bromo-7-nitroquinoline (CAS 2638501-76-3) is a chemical compound with the molecular formula C9H5BrN2O2 and a molecular weight of 253.05 g/mol. IUPAC name: 5-bromo-7-nitroquinoline. InChIKey: TWUKJKAWBCXXMM-UHFFFAOYSA-N.
| Molecular formula | C9H5BrN2O2 |
|---|---|
| Molecular weight | 253.05 g/mol |
| IUPAC name | 5-bromo-7-nitroquinoline |
| InChIKey | TWUKJKAWBCXXMM-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C(C=C2Br)[N+](=O)[O-])N=C1 |
Computed by PubChem (NCBI)