Products 2639406-13-4
CAS 2639406-13-4 appears in our catalog under these names: 4-bromo-3-{[(tert-butoxy)carbonyl]amino}thiophene-2-carboxylic acid, 98%, 98%, 4-Bromo-3-((tert-butoxycarbonyl)amino)thiophene-2-carboxylic acid, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg.
4-bromo-3-[(2-methylpropan-2-yl)oxycarbonylamino]thiophene-2-carboxylic acid (CAS 2639406-13-4) is a chemical compound with the molecular formula C10H12BrNO4S and a molecular weight of 322.18 g/mol. IUPAC name: 4-bromo-3-[(2-methylpropan-2-yl)oxycarbonylamino]thiophene-2-carboxylic acid. InChIKey: TWPQWOZOKIEEOE-UHFFFAOYSA-N.
| Molecular formula | C10H12BrNO4S |
|---|---|
| Molecular weight | 322.18 g/mol |
| IUPAC name | 4-bromo-3-[(2-methylpropan-2-yl)oxycarbonylamino]thiophene-2-carboxylic acid |
| InChIKey | TWPQWOZOKIEEOE-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=C(SC=C1Br)C(=O)O |
Computed by PubChem (NCBI)