Products 2639626-37-0
CAS 2639626-37-0 appears in our catalog under these names: 4-(3-Pyrrolidinyl)benzoic acid hydrochloride, 95%, 95%, 4-(Pyrrolidin-3-yl)benzoic acid hydrochloride, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg.
4-pyrrolidin-3-ylbenzoic acid;hydrochloride (CAS 2639626-37-0) is a chemical compound with the molecular formula C11H14ClNO2 and a molecular weight of 227.69 g/mol. IUPAC name: 4-pyrrolidin-3-ylbenzoic acid;hydrochloride. InChIKey: UUGLTXUIHJWIBM-UHFFFAOYSA-N.
| Molecular formula | C11H14ClNO2 |
|---|---|
| Molecular weight | 227.69 g/mol |
| IUPAC name | 4-pyrrolidin-3-ylbenzoic acid;hydrochloride |
| InChIKey | UUGLTXUIHJWIBM-UHFFFAOYSA-N |
| SMILES | C1CNCC1C2=CC=C(C=C2)C(=O)O.Cl |
Computed by PubChem (NCBI)