Products 2641249-93-4
CAS 2641249-93-4 is the registry number for 7-Chloro-2,2,3,3-tetramethyl-2,3-dihydrobenzofuran, >95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
7-chloro-2,2,3,3-tetramethyl-1-benzofuran (CAS 2641249-93-4) is a chemical compound with the molecular formula C12H15ClO and a molecular weight of 210.70 g/mol. IUPAC name: 7-chloro-2,2,3,3-tetramethyl-1-benzofuran. InChIKey: CETMSSGQRCCWFU-UHFFFAOYSA-N.
| Molecular formula | C12H15ClO |
|---|---|
| Molecular weight | 210.70 g/mol |
| IUPAC name | 7-chloro-2,2,3,3-tetramethyl-1-benzofuran |
| InChIKey | CETMSSGQRCCWFU-UHFFFAOYSA-N |
| SMILES | CC1(C2=C(C(=CC=C2)Cl)OC1(C)C)C |
Computed by PubChem (NCBI)