CAS 2641915-79-7 is the registry number for 6-(Phenylthio)-(1,2,4)triazolo(1,5-a)pyridin-2-amine, 98%. Offered by: AmBeed. Available pack sizes: 1g.
6-phenylsulfanyl-[1,2,4]triazolo[1,5-a]pyridin-2-amine (CAS 2641915-79-7) is a chemical compound with the molecular formula C12H10N4S and a molecular weight of 242.30 g/mol. IUPAC name: 6-phenylsulfanyl-[1,2,4]triazolo[1,5-a]pyridin-2-amine. InChIKey: YGKQSIBZRSGBEA-UHFFFAOYSA-N.
| Molecular formula | C12H10N4S |
|---|---|
| Molecular weight | 242.30 g/mol |
| IUPAC name | 6-phenylsulfanyl-[1,2,4]triazolo[1,5-a]pyridin-2-amine |
| InChIKey | YGKQSIBZRSGBEA-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)SC2=CN3C(=NC(=N3)N)C=C2 |
Computed by PubChem (NCBI)