Products 1311313-66-2
CAS 1311313-66-2 is the registry number for 4-(4-(1H-Pyrazol-1-yl)phenyl)-1,3-thiazol-2-amine. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
4-(4-pyrazol-1-ylphenyl)-1,3-thiazol-2-amine (CAS 1311313-66-2) is a chemical compound with the molecular formula C12H10N4S and a molecular weight of 242.30 g/mol. IUPAC name: 4-(4-pyrazol-1-ylphenyl)-1,3-thiazol-2-amine. InChIKey: BMBOADCUJCZNQE-UHFFFAOYSA-N.
| Molecular formula | C12H10N4S |
|---|---|
| Molecular weight | 242.30 g/mol |
| IUPAC name | 4-(4-pyrazol-1-ylphenyl)-1,3-thiazol-2-amine |
| InChIKey | BMBOADCUJCZNQE-UHFFFAOYSA-N |
| SMILES | C1=CN(N=C1)C2=CC=C(C=C2)C3=CSC(=N3)N |
Computed by PubChem (NCBI)