Products 56156-23-1
CAS 56156-23-1 appears in our catalog under these names: 1-Benzyl-1H-pyrazolo(3,4-d)pyrimidine-4-thiol, 98%, 1-Benzyl-1H-pyrazolo(3,4-d)pyrimidine-4-thiol. Offered by: AmBeed, Biosynth. Available pack sizes: 10g, 5g, 2,5g, 250mg.
1-benzyl-7H-pyrazolo[5,4-d]pyrimidine-4-thione (CAS 56156-23-1) is a chemical compound with the molecular formula C12H10N4S and a molecular weight of 242.30 g/mol. IUPAC name: 1-benzyl-7H-pyrazolo[5,4-d]pyrimidine-4-thione. InChIKey: SLCUJURZNGAVEX-UHFFFAOYSA-N.
| Molecular formula | C12H10N4S |
|---|---|
| Molecular weight | 242.30 g/mol |
| IUPAC name | 1-benzyl-7H-pyrazolo[5,4-d]pyrimidine-4-thione |
| InChIKey | SLCUJURZNGAVEX-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CN2C3=C(C=N2)C(=S)N=CN3 |
Computed by PubChem (NCBI)