CAS 914636-21-8 is the registry number for 2-Amino-1-(1-aza-2-(4-methylthiophenyl)vinyl)ethene-1,2-dicarbonitrile. Offered by: Biosynth. Available pack sizes: 2g, 1g.
(Z)-2-amino-3-[(4-methylsulfanylphenyl)methylideneamino]but-2-enedinitrile (CAS 914636-21-8) is a chemical compound with the molecular formula C12H10N4S and a molecular weight of 242.30 g/mol. IUPAC name: (Z)-2-amino-3-[(4-methylsulfanylphenyl)methylideneamino]but-2-enedinitrile. InChIKey: XKJSGGYMECUZTM-UALXHEDLSA-N.
| Molecular formula | C12H10N4S |
|---|---|
| Molecular weight | 242.30 g/mol |
| IUPAC name | (Z)-2-amino-3-[(4-methylsulfanylphenyl)methylideneamino]but-2-enedinitrile |
| InChIKey | XKJSGGYMECUZTM-UALXHEDLSA-N |
| SMILES | CSC1=CC=C(C=C1)C=N/C(=C(/C#N)\N)/C#N |
Computed by PubChem (NCBI)