CAS 113246-86-9 appears in our catalog under these names: 4-Hydrazino-5-phenylthieno[2,3-d]pyrimidine, 95%, 4-Hydrazinyl-5-phenylthieno(2,3-d)pyrimidine, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 1g, 250mg.
(5-phenylthieno[2,3-d]pyrimidin-4-yl)hydrazine (CAS 113246-86-9) is a chemical compound with the molecular formula C12H10N4S and a molecular weight of 242.30 g/mol. IUPAC name: (5-phenylthieno[2,3-d]pyrimidin-4-yl)hydrazine. InChIKey: HKYLLTSMUHTLBT-UHFFFAOYSA-N.
| Molecular formula | C12H10N4S |
|---|---|
| Molecular weight | 242.30 g/mol |
| IUPAC name | (5-phenylthieno[2,3-d]pyrimidin-4-yl)hydrazine |
| InChIKey | HKYLLTSMUHTLBT-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CSC3=NC=NC(=C23)NN |
Computed by PubChem (NCBI)