CAS 1351620-57-9 is the registry number for 3-(p-Tolyl)-[1,2,4]triazolo[4,3-b]pyridazine-6-thiol, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
3-(4-methylphenyl)-5H-[1,2,4]triazolo[4,3-b]pyridazine-6-thione (CAS 1351620-57-9) is a chemical compound with the molecular formula C12H10N4S and a molecular weight of 242.30 g/mol. IUPAC name: 3-(4-methylphenyl)-5H-[1,2,4]triazolo[4,3-b]pyridazine-6-thione. InChIKey: RJICKZQTFDKDJN-UHFFFAOYSA-N.
| Molecular formula | C12H10N4S |
|---|---|
| Molecular weight | 242.30 g/mol |
| IUPAC name | 3-(4-methylphenyl)-5H-[1,2,4]triazolo[4,3-b]pyridazine-6-thione |
| InChIKey | RJICKZQTFDKDJN-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2=NN=C3N2NC(=S)C=C3 |
Computed by PubChem (NCBI)