Products 264276-41-7
CAS 264276-41-7 appears in our catalog under these names: 6-Bromo-2-oxo-1,2,3,4-tetrahydroquinoline-4-carboxylic acid, 6-Bromo-2-oxo-1,2,3,4-tetrahydroquinoline-4-carboxylic acid, 95%. Offered by: Biosynth, Ambeed, BLDpharm, Chemat. Available pack sizes: 0,5g, 50mg, 250mg, 1g, 100mg.
6-bromo-2-oxo-3,4-dihydro-1H-quinoline-4-carboxylic acid (CAS 264276-41-7) is a chemical compound with the molecular formula C10H8BrNO3 and a molecular weight of 270.08 g/mol. IUPAC name: 6-bromo-2-oxo-3,4-dihydro-1H-quinoline-4-carboxylic acid. InChIKey: PWVKWQYNGPHDFR-UHFFFAOYSA-N.
| Molecular formula | C10H8BrNO3 |
|---|---|
| Molecular weight | 270.08 g/mol |
| IUPAC name | 6-bromo-2-oxo-3,4-dihydro-1H-quinoline-4-carboxylic acid |
| InChIKey | PWVKWQYNGPHDFR-UHFFFAOYSA-N |
| SMILES | C1C(C2=C(C=CC(=C2)Br)NC1=O)C(=O)O |
Computed by PubChem (NCBI)