CAS 26454-80-8 is the registry number for 2–(2–Oxo–2–P–Tolylethyl)Malononitrile. Offered by: GLPBio. Available pack sizes: 100mg, 1g, 250mg.
2-[2-(4-methylphenyl)-2-oxoethyl]propanedinitrile (CAS 26454-80-8) is a chemical compound with the molecular formula C12H10N2O and a molecular weight of 198.22 g/mol. IUPAC name: 2-[2-(4-methylphenyl)-2-oxoethyl]propanedinitrile. InChIKey: CNFZHBDTYRQXSY-UHFFFAOYSA-N.
| Molecular formula | C12H10N2O |
|---|---|
| Molecular weight | 198.22 g/mol |
| IUPAC name | 2-[2-(4-methylphenyl)-2-oxoethyl]propanedinitrile |
| InChIKey | CNFZHBDTYRQXSY-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C(=O)CC(C#N)C#N |
Computed by PubChem (NCBI)