Products 2648961-89-9

CAS 2648961-89-9 is the registry number for (1r,3r)-3-phenoxycyclobutane-1-carboxylic acid, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.

Structural formula: {0} (CAS {1})

3-phenoxycyclobutane-1-carboxylic acid (CAS 2648961-89-9) is a chemical compound with the molecular formula C11H12O3 and a molecular weight of 192.21 g/mol. IUPAC name: 3-phenoxycyclobutane-1-carboxylic acid. InChIKey: UHQWCVMRTDYEKK-UHFFFAOYSA-N.

Identity
Molecular formulaC11H12O3
Molecular weight192.21 g/mol
IUPAC name3-phenoxycyclobutane-1-carboxylic acid
InChIKeyUHQWCVMRTDYEKK-UHFFFAOYSA-N
SMILESC1C(CC1OC2=CC=CC=C2)C(=O)O

Computed by PubChem (NCBI)