Products 2649066-82-8
CAS 2649066-82-8 is the registry number for tert-butyl N-(5-isocyanatopyrimidin-2-yl)carbamate. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
Tert-butyl N-(5-isocyanatopyrimidin-2-yl)carbamate (CAS 2649066-82-8) is a chemical compound with the molecular formula C10H12N4O3 and a molecular weight of 236.23 g/mol. IUPAC name: tert-butyl N-(5-isocyanatopyrimidin-2-yl)carbamate. InChIKey: HVYSZNQCRNJGHQ-UHFFFAOYSA-N.
| Molecular formula | C10H12N4O3 |
|---|---|
| Molecular weight | 236.23 g/mol |
| IUPAC name | tert-butyl N-(5-isocyanatopyrimidin-2-yl)carbamate |
| InChIKey | HVYSZNQCRNJGHQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=NC=C(C=N1)N=C=O |
Computed by PubChem (NCBI)