CAS 26577-32-2 is the registry number for 2-Phthalimidino-glutaric Acid. Offered by: TRC. Available pack sizes: 100mg.
2-(3-oxo-1H-isoindol-2-yl)pentanedioic acid (CAS 26577-32-2) is a chemical compound with the molecular formula C13H13NO5 and a molecular weight of 263.25 g/mol. IUPAC name: 2-(3-oxo-1H-isoindol-2-yl)pentanedioic acid. InChIKey: RVTDLRPXGAMZGP-UHFFFAOYSA-N.
| Molecular formula | C13H13NO5 |
|---|---|
| Molecular weight | 263.25 g/mol |
| IUPAC name | 2-(3-oxo-1H-isoindol-2-yl)pentanedioic acid |
| InChIKey | RVTDLRPXGAMZGP-UHFFFAOYSA-N |
| SMILES | C1C2=CC=CC=C2C(=O)N1C(CCC(=O)O)C(=O)O |
Computed by PubChem (NCBI)