Products 26586-20-9
CAS 26586-20-9 appears in our catalog under these names: 3-Chloro-4-morpholinobenzoic acid, 95%, 3–Chloro–4–morpholinobenzoic Acid, 3-Chloro-4-morpholinobenzoic Acid, >97%, >97%, 3-Chloro-4-morpholinobenzoic acid, >97%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 25g, 10g, 100mg, 250mg.
3-chloro-4-morpholin-4-ylbenzoic acid (CAS 26586-20-9) is a chemical compound with the molecular formula C11H12ClNO3 and a molecular weight of 241.67 g/mol. IUPAC name: 3-chloro-4-morpholin-4-ylbenzoic acid. InChIKey: GZDHVZCNDDAJPE-UHFFFAOYSA-N.
| Molecular formula | C11H12ClNO3 |
|---|---|
| Molecular weight | 241.67 g/mol |
| IUPAC name | 3-chloro-4-morpholin-4-ylbenzoic acid |
| InChIKey | GZDHVZCNDDAJPE-UHFFFAOYSA-N |
| SMILES | C1COCCN1C2=C(C=C(C=C2)C(=O)O)Cl |
Computed by PubChem (NCBI)