Products 2665660-82-0
CAS 2665660-82-0 is the registry number for Methyl 5-bromo-7-methyl-1H-indole-4-carboxylate, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
Methyl 5-bromo-7-methyl-1H-indole-4-carboxylate (CAS 2665660-82-0) is a chemical compound with the molecular formula C11H10BrNO2 and a molecular weight of 268.11 g/mol. IUPAC name: methyl 5-bromo-7-methyl-1H-indole-4-carboxylate. InChIKey: LIIIRPFXPNIVBC-UHFFFAOYSA-N.
| Molecular formula | C11H10BrNO2 |
|---|---|
| Molecular weight | 268.11 g/mol |
| IUPAC name | methyl 5-bromo-7-methyl-1H-indole-4-carboxylate |
| InChIKey | LIIIRPFXPNIVBC-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C2=C1NC=C2)C(=O)OC)Br |
Computed by PubChem (NCBI)