CAS 26676-02-8 is the registry number for 2-Hydroxy-3-phenyl-6-(trifluoromethyl)-3,4-dihydropyrimidin-4-one, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
3-phenyl-6-(trifluoromethyl)-1H-pyrimidine-2,4-dione (CAS 26676-02-8) is a chemical compound with the molecular formula C11H7F3N2O2 and a molecular weight of 256.18 g/mol. IUPAC name: 3-phenyl-6-(trifluoromethyl)-1H-pyrimidine-2,4-dione. InChIKey: VDLYSLFSLYOAQU-UHFFFAOYSA-N.
| Molecular formula | C11H7F3N2O2 |
|---|---|
| Molecular weight | 256.18 g/mol |
| IUPAC name | 3-phenyl-6-(trifluoromethyl)-1H-pyrimidine-2,4-dione |
| InChIKey | VDLYSLFSLYOAQU-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N2C(=O)C=C(NC2=O)C(F)(F)F |
Computed by PubChem (NCBI)