Products 2668225-98-5
CAS 2668225-98-5 is the registry number for BTK ligand 15. Offered by: MedChemExpress. Available pack sizes: Get quote.
5-(1,3-benzodioxol-5-yl)spiro[1H-pyrrolo[2,3-b]pyridine-3,4'-piperidine]-2-one (CAS 2668225-98-5) is a chemical compound with the molecular formula C18H17N3O3 and a molecular weight of 323.3 g/mol. IUPAC name: 5-(1,3-benzodioxol-5-yl)spiro[1H-pyrrolo[2,3-b]pyridine-3,4'-piperidine]-2-one. InChIKey: MESVDSJUAPVLBO-UHFFFAOYSA-N.
| Molecular formula | C18H17N3O3 |
|---|---|
| Molecular weight | 323.3 g/mol |
| IUPAC name | 5-(1,3-benzodioxol-5-yl)spiro[1H-pyrrolo[2,3-b]pyridine-3,4'-piperidine]-2-one |
| InChIKey | MESVDSJUAPVLBO-UHFFFAOYSA-N |
| SMILES | C1CNCCC12C3=C(NC2=O)N=CC(=C3)C4=CC5=C(C=C4)OCO5 |
Computed by PubChem (NCBI)
Synonyms:
BTK ligand 15, orb2944832