Products 2668297-70-7
CAS 2668297-70-7 is the registry number for ZDWX-25. Offered by: MedChemExpress. Available pack sizes: Get quote.
Methyl 8-(cyclopropanecarbonylamino)-9H-carbazole-2-carboxylate (CAS 2668297-70-7) is a chemical compound with the molecular formula C18H16N2O3 and a molecular weight of 308.3 g/mol. IUPAC name: methyl 8-(cyclopropanecarbonylamino)-9H-carbazole-2-carboxylate. InChIKey: HYXRYQYCRBSSIY-UHFFFAOYSA-N.
| Molecular formula | C18H16N2O3 |
|---|---|
| Molecular weight | 308.3 g/mol |
| IUPAC name | methyl 8-(cyclopropanecarbonylamino)-9H-carbazole-2-carboxylate |
| InChIKey | HYXRYQYCRBSSIY-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC2=C(C=C1)C3=C(N2)C(=CC=C3)NC(=O)C4CC4 |
Computed by PubChem (NCBI)