CAS 26732-06-9 is the registry number for 1-(4-Chlorophenyl)pentane-1,3-dione, 95%. Offered by: AmBeed. Available pack sizes: 5g.
1-(4-chlorophenyl)pentane-1,3-dione (CAS 26732-06-9) is a chemical compound with the molecular formula C11H11ClO2 and a molecular weight of 210.65 g/mol. IUPAC name: 1-(4-chlorophenyl)pentane-1,3-dione. InChIKey: HCOWJMBVCOCHFP-UHFFFAOYSA-N.
| Molecular formula | C11H11ClO2 |
|---|---|
| Molecular weight | 210.65 g/mol |
| IUPAC name | 1-(4-chlorophenyl)pentane-1,3-dione |
| InChIKey | HCOWJMBVCOCHFP-UHFFFAOYSA-N |
| SMILES | CCC(=O)CC(=O)C1=CC=C(C=C1)Cl |
Computed by PubChem (NCBI)