Products 2673369-01-0
CAS 2673369-01-0 is the registry number for 2-Chloro-7,7-dimethyl-7,8-dihydro-5H-pyrano[4,3-b]pyridin-5-one, 98%. Offered by: Fluorochem, Chemat. Available pack sizes: 100mg, 250mg, 1g.
2-chloro-7,7-dimethyl-8H-pyrano[4,3-b]pyridin-5-one (CAS 2673369-01-0) is a chemical compound with the molecular formula C10H10ClNO2 and a molecular weight of 211.64 g/mol. IUPAC name: 2-chloro-7,7-dimethyl-8H-pyrano[4,3-b]pyridin-5-one. InChIKey: VIMQPSFZSWZRPU-UHFFFAOYSA-N.
| Molecular formula | C10H10ClNO2 |
|---|---|
| Molecular weight | 211.64 g/mol |
| IUPAC name | 2-chloro-7,7-dimethyl-8H-pyrano[4,3-b]pyridin-5-one |
| InChIKey | VIMQPSFZSWZRPU-UHFFFAOYSA-N |
| SMILES | CC1(CC2=C(C=CC(=N2)Cl)C(=O)O1)C |
Computed by PubChem (NCBI)