CAS 2673370-07-3 is the registry number for 4-Bromo-6-chloro-1-methoxy-2,7-naphthyridine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-bromo-6-chloro-1-methoxy-2,7-naphthyridine (CAS 2673370-07-3) is a chemical compound with the molecular formula C9H6BrClN2O and a molecular weight of 273.51 g/mol. IUPAC name: 4-bromo-6-chloro-1-methoxy-2,7-naphthyridine. InChIKey: CGEQEDQWAGSGIX-UHFFFAOYSA-N.
| Molecular formula | C9H6BrClN2O |
|---|---|
| Molecular weight | 273.51 g/mol |
| IUPAC name | 4-bromo-6-chloro-1-methoxy-2,7-naphthyridine |
| InChIKey | CGEQEDQWAGSGIX-UHFFFAOYSA-N |
| SMILES | COC1=NC=C(C2=CC(=NC=C21)Cl)Br |
Computed by PubChem (NCBI)