Products 2676865-17-9
CAS 2676865-17-9 is the registry number for Ethyl 4-nitro-1,2,3,5,6,7-hexahydro-s-indacene-2-carboxylate, 97%. Offered by: Ambeed, BLDpharm, Chemat. Available pack sizes: 100mg, 250mg, 1g.
Ethyl 4-nitro-1,2,3,5,6,7-hexahydro-s-indacene-2-carboxylate (CAS 2676865-17-9) is a chemical compound with the molecular formula C15H17NO4 and a molecular weight of 275.30 g/mol. IUPAC name: ethyl 4-nitro-1,2,3,5,6,7-hexahydro-s-indacene-2-carboxylate. InChIKey: OKFXQSCGNAREFL-UHFFFAOYSA-N.
| Molecular formula | C15H17NO4 |
|---|---|
| Molecular weight | 275.30 g/mol |
| IUPAC name | ethyl 4-nitro-1,2,3,5,6,7-hexahydro-s-indacene-2-carboxylate |
| InChIKey | OKFXQSCGNAREFL-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1CC2=C(C1)C(=C3CCCC3=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)