Products 2680532-20-9
CAS 2680532-20-9 is the registry number for Methyl 4-bromo-2-(2-cyanopropan-2-yl)benzoate, >97%, >97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.
Methyl 4-bromo-2-(2-cyanopropan-2-yl)benzoate (CAS 2680532-20-9) is a chemical compound with the molecular formula C12H12BrNO2 and a molecular weight of 282.13 g/mol. IUPAC name: methyl 4-bromo-2-(2-cyanopropan-2-yl)benzoate. InChIKey: SVRQNJOKXUNIOG-UHFFFAOYSA-N.
| Molecular formula | C12H12BrNO2 |
|---|---|
| Molecular weight | 282.13 g/mol |
| IUPAC name | methyl 4-bromo-2-(2-cyanopropan-2-yl)benzoate |
| InChIKey | SVRQNJOKXUNIOG-UHFFFAOYSA-N |
| SMILES | CC(C)(C#N)C1=C(C=CC(=C1)Br)C(=O)OC |
Computed by PubChem (NCBI)