Products 2680806-95-3
CAS 2680806-95-3 is the registry number for benzyl N-[(6-chloropyridin-3-yl)methyl]carbamate, 95%. Offered by: Chemat. Available pack sizes: 1g.
Benzyl N-[(6-chloro-3-pyridinyl)methyl]carbamate (CAS 2680806-95-3) is a chemical compound with the molecular formula C14H13ClN2O2 and a molecular weight of 276.72 g/mol. IUPAC name: benzyl N-[(6-chloro-3-pyridinyl)methyl]carbamate. InChIKey: BMABTFPHBRIYNO-UHFFFAOYSA-N.
| Molecular formula | C14H13ClN2O2 |
|---|---|
| Molecular weight | 276.72 g/mol |
| IUPAC name | benzyl N-[(6-chloro-3-pyridinyl)methyl]carbamate |
| InChIKey | BMABTFPHBRIYNO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)NCC2=CN=C(C=C2)Cl |
Computed by PubChem (NCBI)