CAS 26838-86-8 appears in our catalog under these names: Picosulfate Impurity 2, Picosulfate Impurity 10, Phenyl 2-pyridinecarboxylate. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 500mg.
Phenyl pyridine-2-carboxylate (CAS 26838-86-8) is a chemical compound with the molecular formula C12H9NO2 and a molecular weight of 199.20 g/mol. IUPAC name: phenyl pyridine-2-carboxylate. InChIKey: JDCDHJSQZSHBJT-UHFFFAOYSA-N.
| Molecular formula | C12H9NO2 |
|---|---|
| Molecular weight | 199.20 g/mol |
| IUPAC name | phenyl pyridine-2-carboxylate |
| InChIKey | JDCDHJSQZSHBJT-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OC(=O)C2=CC=CC=N2 |
Computed by PubChem (NCBI)