Products 26850-25-9
CAS 26850-25-9 appears in our catalog under these names: 1-(4-Hydroxyphenyl)imidazolidine-2,4-dione, 95%, 1-(4-Hydroxyphenyl)imidazolidine-2,4-dione. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 250mg, 5g, 2,5g.
1-(4-hydroxyphenyl)imidazolidine-2,4-dione (CAS 26850-25-9) is a chemical compound with the molecular formula C9H8N2O3 and a molecular weight of 192.17 g/mol. IUPAC name: 1-(4-hydroxyphenyl)imidazolidine-2,4-dione. InChIKey: AJSRHILLPJYTMO-UHFFFAOYSA-N.
| Molecular formula | C9H8N2O3 |
|---|---|
| Molecular weight | 192.17 g/mol |
| IUPAC name | 1-(4-hydroxyphenyl)imidazolidine-2,4-dione |
| InChIKey | AJSRHILLPJYTMO-UHFFFAOYSA-N |
| SMILES | C1C(=O)NC(=O)N1C2=CC=C(C=C2)O |
Computed by PubChem (NCBI)