CAS 26889-86-1 is the registry number for N-(2-Aminoethyl)-3-hydroxy-2-naphthamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
N-(2-aminoethyl)-3-hydroxynaphthalene-2-carboxamide (CAS 26889-86-1) is a chemical compound with the molecular formula C13H14N2O2 and a molecular weight of 230.26 g/mol. IUPAC name: N-(2-aminoethyl)-3-hydroxynaphthalene-2-carboxamide. InChIKey: LKDKFADINSRVMX-UHFFFAOYSA-N.
| Molecular formula | C13H14N2O2 |
|---|---|
| Molecular weight | 230.26 g/mol |
| IUPAC name | N-(2-aminoethyl)-3-hydroxynaphthalene-2-carboxamide |
| InChIKey | LKDKFADINSRVMX-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C=C(C(=CC2=C1)C(=O)NCCN)O |
Computed by PubChem (NCBI)