Products 27018-76-4
CAS 27018-76-4 appears in our catalog under these names: 1–Benzylindole–3–carboxylic acid, 1-Benzylindole-3-Carboxylic Acid, 1-Benzylindole-3-carboxylic acid, 98%, 1-Benzyl-1H-Indole-3-Carboxylic Acid, 95%, 95%, 1-benzyl-1H-indole-3-carboxylic acid, 95%. Offered by: GLPBio, Biosynth, Thermo Scientific (Acros), Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 25g, 5g, 10g, 100mg.
1-benzylindole-3-carboxylic acid (CAS 27018-76-4) is a chemical compound with the molecular formula C16H13NO2 and a molecular weight of 251.28 g/mol. IUPAC name: 1-benzylindole-3-carboxylic acid. InChIKey: LVYDDRHDOKXFMW-UHFFFAOYSA-N.
| Molecular formula | C16H13NO2 |
|---|---|
| Molecular weight | 251.28 g/mol |
| IUPAC name | 1-benzylindole-3-carboxylic acid |
| InChIKey | LVYDDRHDOKXFMW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CN2C=C(C3=CC=CC=C32)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
1-Benzyl-1H-indole-3-carboxylic acid, 1-Benzylindole-3-carboxylic acid, 1H-Indole-3-carboxylic acid, 1-(phenylmethyl)-, CBMicro_033327, Cambridge id 5791025, Oprea1_193229, 5-22-03-00037 (Beilstein Handbook Reference), orb3022953, 1-benzylindol-3-carboxylic acid, N-benzylindole-3-carboxylic acid