Products 2702014-71-7

CAS 2702014-71-7 is the registry number for 1-Thia-6-azaspiro(3.5)nonane 1,1-dioxide hydrochloride, 97+%. Offered by: AmBeed. Available pack sizes: 250mg, 1g.

1lambda6-thia-8-azaspiro[3.5]nonane 1,1-dioxide;hydrochloride (CAS 2702014-71-7) is a chemical compound with the molecular formula C7H14ClNO2S and a molecular weight of 211.71 g/mol. IUPAC name: 1lambda6-thia-8-azaspiro[3.5]nonane 1,1-dioxide;hydrochloride. InChIKey: CFWADAMMOKVGRT-UHFFFAOYSA-N.

Identity
Molecular formulaC7H14ClNO2S
Molecular weight211.71 g/mol
IUPAC name1lambda6-thia-8-azaspiro[3.5]nonane 1,1-dioxide;hydrochloride
InChIKeyCFWADAMMOKVGRT-UHFFFAOYSA-N
SMILESC1CC2(CCS2(=O)=O)CNC1.Cl

Computed by PubChem (NCBI)