Products 2702446-72-6

CAS 2702446-72-6 is the registry number for CEP-Lysine-d4. Offered by: MedChemExpress. Available pack sizes: 1 mg, 500 μg.

Structural formula: {0} (CAS {1})

(2S)-2-amino-6-[2-(2-carboxy-1,1,2,2-tetradeuterioethyl)pyrrol-1-yl]hexanoic acid (CAS 2702446-72-6) is a chemical compound with the molecular formula C13H20N2O4 and a molecular weight of 272.33 g/mol. IUPAC name: (2S)-2-amino-6-[2-(2-carboxy-1,1,2,2-tetradeuterioethyl)pyrrol-1-yl]hexanoic acid. InChIKey: GUYNPRDOGAXJKQ-YUQOGSRCSA-N.

Identity
Molecular formulaC13H20N2O4
Molecular weight272.33 g/mol
IUPAC name(2S)-2-amino-6-[2-(2-carboxy-1,1,2,2-tetradeuterioethyl)pyrrol-1-yl]hexanoic acid
InChIKeyGUYNPRDOGAXJKQ-YUQOGSRCSA-N
SMILES[2H]C([2H])(C1=CC=CN1CCCC[C@@H](C(=O)O)N)C([2H])([2H])C(=O)O

Computed by PubChem (NCBI)

Synonyms: CEP-Lysine-d4