CAS 2702446-72-6 is the registry number for CEP-Lysine-d4. Offered by: MedChemExpress. Available pack sizes: 1 mg, 500 μg.
(2S)-2-amino-6-[2-(2-carboxy-1,1,2,2-tetradeuterioethyl)pyrrol-1-yl]hexanoic acid (CAS 2702446-72-6) is a chemical compound with the molecular formula C13H20N2O4 and a molecular weight of 272.33 g/mol. IUPAC name: (2S)-2-amino-6-[2-(2-carboxy-1,1,2,2-tetradeuterioethyl)pyrrol-1-yl]hexanoic acid. InChIKey: GUYNPRDOGAXJKQ-YUQOGSRCSA-N.
| Molecular formula | C13H20N2O4 |
|---|---|
| Molecular weight | 272.33 g/mol |
| IUPAC name | (2S)-2-amino-6-[2-(2-carboxy-1,1,2,2-tetradeuterioethyl)pyrrol-1-yl]hexanoic acid |
| InChIKey | GUYNPRDOGAXJKQ-YUQOGSRCSA-N |
| SMILES | [2H]C([2H])(C1=CC=CN1CCCC[C@@H](C(=O)O)N)C([2H])([2H])C(=O)O |
Computed by PubChem (NCBI)