CAS 2703493-29-0 appears in our catalog under these names: N–methoxy Mephedrone (hydrochloride), N-Methoxy mephedrone (hydrochloride). Offered by: GLPBio, MedChemExpress. Available pack sizes: 1mg, 5mg, 5 mg, 1 mg.
2-[methoxy(methyl)amino]-1-(4-methylphenyl)propan-1-one;hydrochloride (CAS 2703493-29-0) is a chemical compound with the molecular formula C12H18ClNO2 and a molecular weight of 243.73 g/mol. IUPAC name: 2-[methoxy(methyl)amino]-1-(4-methylphenyl)propan-1-one;hydrochloride. InChIKey: MLSCTVYJXHNWOM-UHFFFAOYSA-N.
| Molecular formula | C12H18ClNO2 |
|---|---|
| Molecular weight | 243.73 g/mol |
| IUPAC name | 2-[methoxy(methyl)amino]-1-(4-methylphenyl)propan-1-one;hydrochloride |
| InChIKey | MLSCTVYJXHNWOM-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C(=O)C(C)N(C)OC.Cl |
Computed by PubChem (NCBI)