Products 2703752-50-3
CAS 2703752-50-3 is the registry number for 5-Bromo-7-chloro-2,3-dihydro-1H-inden-1-ol, 97%. Offered by: Ambeed, Chemat, Fluorochem, BLDpharm. Available pack sizes: 100mg, 250mg, 1g, 5g, 50mg.
5-bromo-7-chloro-2,3-dihydro-1H-inden-1-ol (CAS 2703752-50-3) is a chemical compound with the molecular formula C9H8BrClO and a molecular weight of 247.51 g/mol. IUPAC name: 5-bromo-7-chloro-2,3-dihydro-1H-inden-1-ol. InChIKey: XACMIFORAPHJLQ-UHFFFAOYSA-N.
| Molecular formula | C9H8BrClO |
|---|---|
| Molecular weight | 247.51 g/mol |
| IUPAC name | 5-bromo-7-chloro-2,3-dihydro-1H-inden-1-ol |
| InChIKey | XACMIFORAPHJLQ-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C1O)C(=CC(=C2)Br)Cl |
Computed by PubChem (NCBI)