Products 2703752-59-2
CAS 2703752-59-2 is the registry number for METHYL 7-HYDROXY-1,5-NAPHTHYRIDINE-3-CARBOXYLATE, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
Methyl 7-hydroxy-1,5-naphthyridine-3-carboxylate (CAS 2703752-59-2) is a chemical compound with the molecular formula C10H8N2O3 and a molecular weight of 204.18 g/mol. IUPAC name: methyl 7-hydroxy-1,5-naphthyridine-3-carboxylate. InChIKey: WQAIFOOYOULOJJ-UHFFFAOYSA-N.
| Molecular formula | C10H8N2O3 |
|---|---|
| Molecular weight | 204.18 g/mol |
| IUPAC name | methyl 7-hydroxy-1,5-naphthyridine-3-carboxylate |
| InChIKey | WQAIFOOYOULOJJ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC2=C(C=C(C=N2)O)N=C1 |
Computed by PubChem (NCBI)