CAS 2703779-10-4 is the registry number for 5-Bromo-3,3-difluoro-2,3-dihydro-1H-inden-1-amine, 95%. Offered by: AmBeed. Available pack sizes: 1g, 250mg.
5-bromo-3,3-difluoro-1,2-dihydroinden-1-amine (CAS 2703779-10-4) is a chemical compound with the molecular formula C9H8BrF2N and a molecular weight of 248.07 g/mol. IUPAC name: 5-bromo-3,3-difluoro-1,2-dihydroinden-1-amine. InChIKey: DSGLRPGIGWVHIA-UHFFFAOYSA-N.
| Molecular formula | C9H8BrF2N |
|---|---|
| Molecular weight | 248.07 g/mol |
| IUPAC name | 5-bromo-3,3-difluoro-1,2-dihydroinden-1-amine |
| InChIKey | DSGLRPGIGWVHIA-UHFFFAOYSA-N |
| SMILES | C1C(C2=C(C1(F)F)C=C(C=C2)Br)N |
Computed by PubChem (NCBI)