Products 2821068-07-7
CAS 2821068-07-7 is the registry number for LSD1/2-IN-3. Offered by: MedChemExpress. Available pack sizes: Get quote.
Cis-(1R,2R)-2-(4-bromo-3,5-difluorophenyl)cyclopropan-1-amine (CAS 2821068-07-7) is a chemical compound with the molecular formula C9H8BrF2N and a molecular weight of 248.07 g/mol. IUPAC name: cis-(1R,2R)-2-(4-bromo-3,5-difluorophenyl)cyclopropan-1-amine. InChIKey: VEESSMHTAMEHGS-SVGQVSJJSA-N.
| Molecular formula | C9H8BrF2N |
|---|---|
| Molecular weight | 248.07 g/mol |
| IUPAC name | cis-(1R,2R)-2-(4-bromo-3,5-difluorophenyl)cyclopropan-1-amine |
| InChIKey | VEESSMHTAMEHGS-SVGQVSJJSA-N |
| SMILES | C1[C@@H]([C@@H]1N)C2=CC(=C(C(=C2)F)Br)F |
Computed by PubChem (NCBI)